1,3-bis(bromomethyl)-2,4,5,6-tetrachloro-benzene structure
|
Common Name | 1,3-bis(bromomethyl)-2,4,5,6-tetrachloro-benzene | ||
|---|---|---|---|---|
| CAS Number | 21969-67-5 | Molecular Weight | 401.73700 | |
| Density | 2.047g/cm3 | Boiling Point | 383.5ºC at 760 mmHg | |
| Molecular Formula | C8H4Br2Cl4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | 1,3-bis(bromomethyl)-2,4,5,6-tetrachlorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.047g/cm3 |
|---|---|
| Boiling Point | 383.5ºC at 760 mmHg |
| Molecular Formula | C8H4Br2Cl4 |
| Molecular Weight | 401.73700 |
| Flash Point | 208.2ºC |
| Exact Mass | 397.74300 |
| LogP | 6.09000 |
| Vapour Pressure | 9.65E-06mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | XCBJIROLICUXQV-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(CBr)c(Cl)c(CBr)c1Cl |
|
~%
1,3-bis(bromome... CAS#:21969-67-5 |
| Literature: Dynamit Nobel Aktiengesellschaft Patent: US3981936 A1, 1976 ; |
|
~76%
1,3-bis(bromome... CAS#:21969-67-5 |
| Literature: Ravikanth, Mangalampalli; Reddy, Damodar; Misra, Ashutosh; Chandrashekar, Tavarekere K. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1993 , # 7 p. 1137 - 1142 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| m-xylene,|A,|A'-dibromo-2,4,5,6-tetrachloro |