6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one
Modify Date: 2026-07-05 11:02:55
![6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one Structure](https://www.chemsrc.com/extcaspic/087/2198196-34-6.png)
6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one structure
|
Common Name | 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 2198196-34-6 | Molecular Weight | 297.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15N7O |
|---|---|
| Molecular Weight | 297.32 |
| InChIKey | FCGHFSZGKIZSCC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(=O)n(CC2CN(c3ncnc4nc[nH]c34)C2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one? |
| A: The English name of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one is 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one. |
| Q: What is the CAS number of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one? |
| A: CAS number of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one is 2198196-34-6. |
| Q: What is the Chinese name of 2198196-34-6? |
| A: Chinese name of 2198196-34-6 is 2198196-34-6. |
| Q: What is the InChIKey of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one? |
| A: InChIKey of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one is FCGHFSZGKIZSCC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one? |
| A: Molecular weight of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one is 297.32. |
| Q: What is the SMILES notation of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one? |
| A: SMILES notation of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one is Cc1ccc(=O)n(CC2CN(c3ncnc4nc[nH]c34)C2)n1. |
| Q: What is the molecular formula of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one? |
| A: Molecular formula of 6-methyl-2-{[1-(9H-purin-6-yl)azetidin-3-yl]methyl}-2,3-dihydropyridazin-3-one is C14H15N7O. |