(R)-Citalopram oxalate structure
|
Common Name | (R)-Citalopram oxalate | ||
|---|---|---|---|---|
| CAS Number | 219861-53-7 | Molecular Weight | 414.42700 | |
| Density | N/A | Boiling Point | 591.2ºC at 760 mmHg | |
| Molecular Formula | C22H23FN2O5 | Melting Point | 153-155ºC | |
| MSDS | N/A | Flash Point | 311.3ºC | |
Use of (R)-Citalopram oxalate(R)-Citalopram oxalate is a less active enantiomer of Escitalopram Oxalate, a potent and selective inhibitor of serotonin reuptake. |
| Name | (1R)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile,oxalic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 591.2ºC at 760 mmHg |
|---|---|
| Melting Point | 153-155ºC |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.42700 |
| Flash Point | 311.3ºC |
| Exact Mass | 414.15900 |
| PSA | 110.86000 |
| LogP | 2.96858 |
| InChIKey | KTGRHKOEFSJQNS-VEIFNGETSA-N |
| SMILES | CN(C)CCCC1(c2ccc(F)cc2)OCc2cc(C#N)ccc21.O=C(O)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
| S-citalopram Oxalate |
| (R)-Citalopram oxalate |
| Citalopram Impurity 1 |