1-[amino(phenyl)methyl]-2-naphthol structure
|
Common Name | 1-[amino(phenyl)methyl]-2-naphthol | ||
|---|---|---|---|---|
| CAS Number | 219897-32-2 | Molecular Weight | 285.76800 | |
| Density | N/A | Boiling Point | 451.1ºC at 760 mmHg | |
| Molecular Formula | C17H16ClNO | Melting Point | N/A | |
| MSDS | USA | Flash Point | 226.6ºC | |
| Name | 1-[amino(phenyl)methyl]naphthalen-2-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 451.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.76800 |
| Flash Point | 226.6ºC |
| Exact Mass | 285.09200 |
| PSA | 46.25000 |
| LogP | 5.09580 |
| Vapour Pressure | 9.38E-09mmHg at 25°C |
| InChIKey | PRQUQNDKNZOGPF-UHFFFAOYSA-N |
| SMILES | Cl.NC(c1ccccc1)c1c(O)ccc2ccccc12 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2922299090 |
|
~%
1-[amino(phenyl... CAS#:219897-32-2 |
| Literature: Bian, Guangling; Yang, Shiwei; Huang, Huayin; Song, Ling Synthesis (Germany), 2013 , vol. 45, # 7 art. no. SS-2012-H0910-OP, p. 899 - 902 |
|
~%
1-[amino(phenyl... CAS#:219897-32-2 |
| Literature: Bian, Guangling; Yang, Shiwei; Huang, Huayin; Song, Ling Synthesis (Germany), 2013 , vol. 45, # 7 art. no. SS-2012-H0910-OP, p. 899 - 902 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UNII-9O08P0V52W |
| 1-aminobenzyl-2-naphthol hydrochloride |
| (+-)-1-(Amino-phenyl-methyl)-[2]naphthol,Hydrochlorid |
| 1-[amino(phenyl)methyl]-2-naphthol hydrochloride |
| BETTI'S BASE HCL SALT |
| Betti base hydrochloride |
| 1-(Amino-phenyl-methyl)-naphthalen-2-ol hydrochloride |
| Betti's base hydrochloride |
| 1-(benzylamino)-2-naphthol hydrochloride |