Benzoic acid,4-[[(methylamino)carbonyl]oxy]-, methyl ester structure
|
Common Name | Benzoic acid,4-[[(methylamino)carbonyl]oxy]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 21998-12-9 | Molecular Weight | 209.19900 | |
| Density | 1.203g/cm3 | Boiling Point | 307.4ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.7ºC | |
| Name | methyl 4-(methylcarbamoyloxy)benzoate |
|---|
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 307.4ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 139.7ºC |
| Exact Mass | 209.06900 |
| PSA | 64.63000 |
| LogP | 1.58230 |
| Vapour Pressure | 0.000726mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | BKFZHVOKDABWQH-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccc(C(=O)OC)cc1 |
|
~30%
Benzoic acid,4-... CAS#:21998-12-9 |
| Literature: Kumaran, G.; Naik, R. H.; Kulkarni, G. H. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 8 p. 893 - 895 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |