Bromo-DragonFLY (hydrochloride)
Modify Date: 2025-11-25 08:59:26
Bromo-DragonFLY (hydrochloride) structure
|
Common Name | Bromo-DragonFLY (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 219986-78-4 | Molecular Weight | 330.60500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bromo-DragonFLY (hydrochloride)Bromo-DragonFLY hydrochloride is associated with fatalities as well as acute intoxications. |
| Name | Bromo-DragonFLY (hydrochloride) |
|---|
| Molecular Formula | C13H13BrClNO2 |
|---|---|
| Molecular Weight | 330.60500 |
| Exact Mass | 328.98200 |
| PSA | 52.30000 |
| LogP | 5.33350 |
| InChIKey | YDIDKNSMQNPNFC-UHFFFAOYSA-N |
| SMILES | CC([NH3+])Cc1c2ccoc2c(Br)c2ccoc12.[Cl-] |