ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate
ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate structure
|
Common Name | ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 220120-58-1 | Molecular Weight | 221.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO3 |
|---|---|
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 47.56000 |
| LogP | 1.86900 |
| InChIKey | NTHSJGDRGIEPKD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNc2cccc(C)c2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2H-1,4-Benzoxazine-2-carboxylicacid,3,4-dihydro-8-methyl-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Molecular formula of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is C12H15NO3. |
| Q: What English synonyms does ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate have? |
| A: English synonyms of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate: 2H-1,4-Benzoxazine-2-carboxylicacid,3,4-dihydro-8-methyl-,ethyl ester. |
| Q: What is the English name of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: The English name of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate. |
| Q: What is the InChIKey of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: InChIKey of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is NTHSJGDRGIEPKD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 220120-58-1? |
| A: Chinese name of 220120-58-1 is 220120-58-1. |
| Q: What is the CAS number of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: CAS number of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 220120-58-1. |
| Q: What is the LogP of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: LogP of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 1.86900. |
| Q: What is the molecular weight of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Molecular weight of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 221.25200. |
| Q: What is the polar surface area (PSA) of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 47.56000. |
| Q: What is the SMILES notation of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: SMILES notation of ethyl 8-methyl-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is CCOC(=O)C1CNc2cccc(C)c2O1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |