ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate structure
|
Common Name | ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 220120-59-2 | Molecular Weight | 225.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12FNO3 |
|---|---|
| Molecular Weight | 225.21600 |
| Exact Mass | 225.08000 |
| PSA | 47.56000 |
| LogP | 1.69970 |
| InChIKey | NHOMLOLSDHZKLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNc2cc(F)ccc2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2H-1,4-Benzoxazine-2-carboxylicacid,6-fluoro-3,4-dihydro-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: LogP of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 1.69970. |
| Q: What is the CAS number of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: CAS number of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 220120-59-2. |
| Q: What is the SMILES notation of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: SMILES notation of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is CCOC(=O)C1CNc2cc(F)ccc2O1. |
| Q: What is the molecular weight of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Molecular weight of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 225.21600. |
| Q: What is the English name of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: The English name of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate. |
| Q: What is the molecular formula of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Molecular formula of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is C11H12FNO3. |
| Q: What is the polar surface area (PSA) of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is 47.56000. |
| Q: What English synonyms does ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate have? |
| A: English synonyms of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate: 2H-1,4-Benzoxazine-2-carboxylicacid,6-fluoro-3,4-dihydro-,ethyl ester. |
| Q: What is the InChIKey of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate? |
| A: InChIKey of ethyl 6-fluoro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate is NHOMLOLSDHZKLL-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |