1-[4-Hydroxy-2-(trifluoromethyl)phenyl]ethanone structure
|
Common Name | 1-[4-Hydroxy-2-(trifluoromethyl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 220227-53-2 | Molecular Weight | 204.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 305.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.7±27.9 °C | |
| Name | 1-[4-hydroxy-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.8±42.0 °C at 760 mmHg |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.146 |
| Flash Point | 138.7±27.9 °C |
| Exact Mass | 204.039810 |
| PSA | 37.30000 |
| LogP | 3.29 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | GKBDTFVRRWGDQM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)cc1C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-Hydroxy-2-(trifluoromethyl)phenyl)ethanone |
| 4'-Hydroxy-2'-trifluoromethylacetophenone |
| 4'-HYDROXY-2'-TRIFLUROMETHYLACETOPHENONE |
| Ethanone, 1-[4-hydroxy-2-(trifluoromethyl)phenyl]- |
| 1-[4-Hydroxy-2-(trifluoromethyl)phenyl]ethanone |