3,4-dimethoxy-2,5-dinitrobenzaldehyde structure
|
Common Name | 3,4-dimethoxy-2,5-dinitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 22028-02-0 | Molecular Weight | 256.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dimethoxy-2,5-dinitrobenzaldehyde |
|---|
| Molecular Formula | C9H8N2O7 |
|---|---|
| Molecular Weight | 256.16900 |
| Exact Mass | 256.03300 |
| PSA | 127.17000 |
| LogP | 2.37910 |
| InChIKey | JWTWHGUZGKQDGG-UHFFFAOYSA-N |
| SMILES | COc1c([N+](=O)[O-])cc(C=O)c([N+](=O)[O-])c1OC |
| HS Code | 2913000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |