2,6-bis(hydroxymethyl)-4-tert-butylphenol structure
|
Common Name | 2,6-bis(hydroxymethyl)-4-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 2203-14-7 | Molecular Weight | 210.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 342.7±11.0 °C at 760 mmHg | |
| Molecular Formula | C12H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.7±13.9 °C | |
| Name | 4-tert-butyl-2,6-bis(hydroxymethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.7±11.0 °C at 760 mmHg |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.270 |
| Flash Point | 161.7±13.9 °C |
| Exact Mass | 210.125595 |
| PSA | 60.69000 |
| LogP | 0.80 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | SIBBGGADHQDMHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CO)c(O)c(CO)c1 |
| HS Code | 2906299090 |
|---|
|
~97%
2,6-bis(hydroxy... CAS#:2203-14-7 |
| Literature: Li, Hui-Jing; Wu, Ying-Ying; Wu, Qin-Xi; Wang, Rui; Dai, Chun-Yang; Shen, Zhi-Lun; Xie, Cheng-Long; Wu, Yan-Chao Organic and Biomolecular Chemistry, 2014 , vol. 12, # 19 p. 3100 - 3107 |
|
~70%
2,6-bis(hydroxy... CAS#:2203-14-7 |
| Literature: Li, Hui-Jing; Wu, Ying-Ying; Wu, Qin-Xi; Wang, Rui; Dai, Chun-Yang; Shen, Zhi-Lun; Xie, Cheng-Long; Wu, Yan-Chao Organic and Biomolecular Chemistry, 2014 , vol. 12, # 19 p. 3100 - 3107 |
|
~%
Detail
|
| Literature: Hanus; Fuchs Journal fuer Praktische Chemie (Leipzig), 1939 , vol. <2> 153, p. 327,335 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-tert-butyl-2,6-dihydroxymethyl phenol |
| 1,3-Benzenedimethanol, 5-(1,1-dimethylethyl)-2-hydroxy- |
| 4-tert-Butyl-2,6-bis(hydroxymethyl)phenol |
| 5-(1,1-Dimethylethyl)-2-hydroxy-1,3-benzenedimethanol |
| 2,6-Bis(hydroxymethyl)-4-(2-methyl-2-propanyl)phenol |
| 2,6-bis(hydroxymethyl)-4-tert-butylphenol |