4-tert-Butylcalix[8]arene
![4-tert-Butylcalix[8]arene Structure](https://image.chemsrc.com/caspic/325/68971-82-4.png)
4-tert-Butylcalix[8]arene structure
|
Common Name | 4-tert-Butylcalix[8]arene | ||
|---|---|---|---|---|
| CAS Number | 68971-82-4 | Molecular Weight | 1297.826 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C88H112O8 | Melting Point | 411-412ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-tert-Butylcalix[8]arene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Melting Point | 411-412ºC(lit.) |
| Molecular Formula | C88H112O8 |
| Molecular Weight | 1297.826 |
| Exact Mass | 1296.835693 |
| PSA | 161.84000 |
| LogP | 24.25 |
| Index of Refraction | 1.582 |
| InChIKey | OLZFZIXORGGLLS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 4 | |
CAS#:50-00-0
CAS#:98-54-4
CAS#:110-88-3
CAS#:2203-14-7
CAS#:78-86-4
CAS#:82452-93-5![4-tert-Butylcalix[5]arene Structure](https://image.chemsrc.com/caspic/440/81475-22-1.png)
CAS#:81475-22-1
CAS#:84161-29-5![4-(tert-butyl)-2,6-bis{[5-(tert-butyl)-2-hydroxyphenyl]methyl}phenol Structure](https://image.chemsrc.com/caspic/476/810-52-6.png)
CAS#:810-52-6![7,13,21,27-tetra-tert-butyl-29,30,31,32-tetrahydroxy-2,3,16,17-tetrahomo-3,17-dioxacalix[4]arene Structure](https://image.chemsrc.com/caspic/260/85097-23-0.png)
CAS#:85097-23-0![4-Sulfocalix[8]arene hydrate structure](https://image.chemsrc.com/caspic/200/137407-62-6.png)
CAS#:137407-62-6
CAS#:92003-63-9![4-tert-butylcalix[8]arene octa-n-propyl ether structure](https://image.chemsrc.com/caspic/332/628304-60-9.png)
CAS#:628304-60-9This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
|
Name: Antitubercular activity against Mycobacterium tuberculosis infected in mouse assessed...
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL4613962
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| para-tert-butylcalix[8]arene |
| MFCD00075392 |
| 5,11,17,23,29,35,41,47-octa-tert-butyl-49,50,51,52,53,54,55,56-octahydroxy-calix[8]arene |
| 5,11,17,23,29,35,41,47-Octakis(2-methyl-2-propanyl)nonacyclo[43.3.1.1.1.1.1.1.1.1]hexapentaconta-1(49),3(56),4,6,9(55),10,12,15(54),16,18,21(53),22,24,27(
 52),28,30,33(51),34,36,39(50),40,42,45,47-tetracosaene-49,50,51,52,53,54,55,56-octol |
| 4-t-Butylcalix[8]arene |
| 5,11,17,23,29,35,41,47-octakis(1,1-dimethylethyl)-49,50,51,52,53,54,55,56-octahydroxycalix[8]arene |
| 5,11,17,23,29,35,41,47-Octa-tert-butylnonacyclo[43.3.1.1.1.1.1.1.1.1]hexapentaconta-1(49),3(56),4,6,9(55),10,12,15(54),16,18,21(53),22,24,27(52),28,30,33(51),34,36,39(50),40,42,45,47-tetracosaene-49,50,51,52,53,54,55,56-octol |
| 5,11,17,23,29,35,41,47-octakis(tert-butyl)-49,50,51,52,53,54,55,56-octakis(hydroxy)calix[8]arene |
| p-tBu-calix[8]arene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-tert-Butylcalix[8]arene? |
| A: The English name of 4-tert-Butylcalix[8]arene is 4-tert-Butylcalix[8]arene. |
| Q: What is the LogP of 4-tert-Butylcalix[8]arene? |
| A: LogP of 4-tert-Butylcalix[8]arene is 24.25. |
| Q: What are the downstream products of 4-tert-Butylcalix[8]arene? |
| A: Related downstream products(CAS) of 4-tert-Butylcalix[8]arene: 82452-93-5;137407-62-6;92003-63-9;628304-60-9. |
| Q: What is the CAS number of 4-tert-Butylcalix[8]arene? |
| A: CAS number of 4-tert-Butylcalix[8]arene is 68971-82-4. |
| Q: What are the upstream materials of 4-tert-Butylcalix[8]arene? |
| A: Related upstream materials(CAS) of 4-tert-Butylcalix[8]arene: 50-00-0;98-54-4;110-88-3;2203-14-7;78-86-4;82452-93-5;81475-22-1;84161-29-5;810-52-6;85097-23-0. |
| Q: What is the InChIKey of 4-tert-Butylcalix[8]arene? |
| A: InChIKey of 4-tert-Butylcalix[8]arene is OLZFZIXORGGLLS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-tert-Butylcalix[8]arene? |
| A: Molecular weight of 4-tert-Butylcalix[8]arene is 1297.826. |
| Q: What is the safety information for 4-tert-Butylcalix[8]arene? |
| A: Safety information for 4-tert-Butylcalix[8]arene: S26;S36. |
| Q: What is the molecular formula of 4-tert-Butylcalix[8]arene? |
| A: Molecular formula of 4-tert-Butylcalix[8]arene is C88H112O8. |
| Q: What is the melting point of 4-tert-Butylcalix[8]arene? |
| A: Melting point of 4-tert-Butylcalix[8]arene is 411-412ºC(lit.). |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |