2-amino-5-phenoxybenzoic acid structure
|
Common Name | 2-amino-5-phenoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 22071-39-2 | Molecular Weight | 229.23100 | |
| Density | 1.311g/cm3 | Boiling Point | 414.498ºC at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.481ºC | |
| Name | 2-amino-5-phenoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 414.498ºC at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23100 |
| Flash Point | 204.481ºC |
| Exact Mass | 229.07400 |
| PSA | 72.55000 |
| LogP | 3.34050 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | DQQGVGXQQYLHTC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccccc2)cc1C(=O)O |
| HS Code | 2922509090 |
|---|
|
~%
2-amino-5-pheno... CAS#:22071-39-2 |
| Literature: METHYLGENE INC. Patent: WO2007/22638 A1, 2007 ; Location in patent: Page/Page column 94; 95 ; |
|
~%
2-amino-5-pheno... CAS#:22071-39-2 |
| Literature: Sues; Moeller Justus Liebigs Annalen der Chemie, 1955 , vol. 593, p. 91,109 |
|
~%
2-amino-5-pheno... CAS#:22071-39-2 |
| Literature: Sues; Moeller Justus Liebigs Annalen der Chemie, 1955 , vol. 593, p. 91,109 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-5-phenoxy-benzoesaeure |
| 2-amino-5-phenoxy-benzoic acid |
| 5-Phenoxy-anthranilsaeure |
| BENZOIC ACID,2-AMINO-5-PHENOXY |