4-[3-(4-methylpiperazin-1-yl)propoxy]aniline structure
|
Common Name | 4-[3-(4-methylpiperazin-1-yl)propoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 220822-26-4 | Molecular Weight | 249.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(4-methylpiperazin-1-yl)propoxy]aniline |
|---|
| Molecular Formula | C14H23N3O |
|---|---|
| Molecular Weight | 249.35200 |
| Exact Mass | 249.18400 |
| PSA | 41.73000 |
| LogP | 1.74210 |
| InChIKey | AHACBCCMXMDLCU-UHFFFAOYSA-N |
| SMILES | CN1CCN(CCCOc2ccc(N)cc2)CC1 |
|
~92%
4-[3-(4-methylp... CAS#:220822-26-4 |
| Literature: Hooper, Malcolm; Imam, S. Haider Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1583 - 1588 |
|
~%
4-[3-(4-methylp... CAS#:220822-26-4 |
| Literature: Hooper, Malcolm; Imam, S. Haider Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1583 - 1588 |
|
~%
4-[3-(4-methylp... CAS#:220822-26-4 |
| Literature: Hooper, Malcolm; Imam, S. Haider Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1583 - 1588 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |