N,N-dimethyl-4,4-diphenylbutanamide structure
|
Common Name | N,N-dimethyl-4,4-diphenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 22101-13-9 | Molecular Weight | 267.36500 | |
| Density | 1.042g/cm3 | Boiling Point | 411.5ºC at 760mmHg | |
| Molecular Formula | C18H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | N,N-dimethyl-4,4-diphenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760mmHg |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.36500 |
| Flash Point | 184.7ºC |
| Exact Mass | 267.16200 |
| PSA | 20.31000 |
| LogP | 3.68690 |
| Vapour Pressure | 5.56E-07mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | USFVUNSWKOVZJB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CCC(c1ccccc1)c1ccccc1 |
|
~75%
N,N-dimethyl-4,... CAS#:22101-13-9 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
|
~%
N,N-dimethyl-4,... CAS#:22101-13-9 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butyramide,N,N-dimethyl-4,4-diphenyl |
| 4,4-Diphenylbutyric acid,N,N-dimethylamide |