Benzenebutanoic acid, g-phenyl- structure
|
Common Name | Benzenebutanoic acid, g-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 14578-67-7 | Molecular Weight | 240.29700 | |
| Density | 1.124g/cm3 | Boiling Point | 377.2ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274ºC | |
| Name | 4,4-diphenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 377.2ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 274ºC |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 3.68330 |
| Vapour Pressure | 2.33E-06mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | FLSBZXWDASEHJU-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4-diphenylbutanedioic acid |
| 4,4-diphenylbutyric acid |
| Benzenebutanoic acid,g-phenyl |
| 4,4-diphenyl-butanoic acid |