3-(3-METHOXYPHENYL)-1,1,1-TRIFLUORO-2-PROPANONE structure
|
Common Name | 3-(3-METHOXYPHENYL)-1,1,1-TRIFLUORO-2-PROPANONE | ||
|---|---|---|---|---|
| CAS Number | 22102-09-6 | Molecular Weight | 218.17200 | |
| Density | 1.237g/cm3 | Boiling Point | 234ºC at 760 mmHg | |
| Molecular Formula | C10H9F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.7ºC | |
| Name | 1,1,1-trifluoro-3-(3-methoxyphenyl)propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 234ºC at 760 mmHg |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17200 |
| Flash Point | 92.7ºC |
| Exact Mass | 218.05500 |
| PSA | 26.30000 |
| LogP | 2.36910 |
| Vapour Pressure | 0.0541mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | CFXRVYZFEKPHSO-UHFFFAOYSA-N |
| SMILES | COc1cccc(CC(=O)C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|
|
~%
3-(3-METHOXYPHE... CAS#:22102-09-6 |
| Literature: Muzalevskiy, Vasiliy M.; Nenajdenko, Valentine G.; Shastin, Aleksey V.; Balenkova, Elizabeth S.; Haufe, Guenter Journal of Fluorine Chemistry, 2008 , vol. 129, # 10 p. 1052 - 1055 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-(3-METHOXYPHENYL)-1,1,1-TRIFLUORO-2-PROPANONE |
| 3-(3-methoxyphenyl)-1,1,1-trifluoroacetone |
| Trifluormethyl-<3-methoxy-benzyl>-keton |