3-(3-IODOPHENYL)-1,1,1-TRIFLUORO-2-PROPANONE structure
|
Common Name | 3-(3-IODOPHENYL)-1,1,1-TRIFLUORO-2-PROPANONE | ||
|---|---|---|---|---|
| CAS Number | 898787-67-2 | Molecular Weight | 314.04300 | |
| Density | 1.801g/cm3 | Boiling Point | 269.9ºC at 760 mmHg | |
| Molecular Formula | C9H6F3IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117ºC | |
| Name | 1,1,1-trifluoro-3-(3-iodophenyl)propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.801g/cm3 |
|---|---|
| Boiling Point | 269.9ºC at 760 mmHg |
| Molecular Formula | C9H6F3IO |
| Molecular Weight | 314.04300 |
| Flash Point | 117ºC |
| Exact Mass | 313.94200 |
| PSA | 17.07000 |
| LogP | 2.96510 |
| Index of Refraction | 1.529 |
| InChIKey | NQYKYSVHYFFSJC-UHFFFAOYSA-N |
| SMILES | O=C(Cc1cccc(I)c1)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-(3-iodophenyl)-1,1,1-trifluoro-2-propanone |