N-(4-aminophenyl)-N,4-dimethyl-benzenesulfonamide structure
|
Common Name | N-(4-aminophenyl)-N,4-dimethyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 22110-09-4 | Molecular Weight | 276.35400 | |
| Density | 1.281g/cm3 | Boiling Point | 466.8ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | N-(4-aminophenyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 466.8ºC at 760 mmHg |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.35400 |
| Flash Point | 236.1ºC |
| Exact Mass | 276.09300 |
| PSA | 71.78000 |
| LogP | 4.06430 |
| Vapour Pressure | 6.88E-09mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | HQIYUJRVUMPNNL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(N)cc2)cc1 |
|
~%
N-(4-aminopheny... CAS#:22110-09-4 |
| Literature: Morgan; Micklethwait Journal of the Chemical Society, 1912 , vol. 101, p. 145 |
|
~%
N-(4-aminopheny... CAS#:22110-09-4 |
| Literature: Morgan; Micklethwait Journal of the Chemical Society, 1912 , vol. 101, p. 145 |
| 5-Amino-N-methyl-p-toluenesulfonanilide |
| N-p-Toluolsulfonyl-N-methyl-p-phenylendiamin |