N-(4-aminophenyl)-5-methylfuran-3-carboxamide
Modify Date: 2025-08-25 21:38:59
N-(4-aminophenyl)-5-methylfuran-3-carboxamide structure
|
Common Name | N-(4-aminophenyl)-5-methylfuran-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 887358-45-4 | Molecular Weight | 216.23600 | |
| Density | 1.274g/cm3 | Boiling Point | 310.2ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.4ºC | |
| Name | N-(4-aminophenyl)-5-methylfuran-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 310.2ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 141.4ºC |
| Exact Mass | 216.09000 |
| PSA | 68.26000 |
| LogP | 3.07670 |
| Index of Refraction | 1.654 |
| InChIKey | GUTHXYNNQOQQPP-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Nc2ccc(N)cc2)co1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-(4-AMINOPHENYL)-5-METHYL-3-FURAMIDE |
| N-(4-aminophenyl)(5-methyl(3-furyl))carboxamide |