6-methyl-4-(trifluoromethyl)-2(1h)-pyridone structure
|
Common Name | 6-methyl-4-(trifluoromethyl)-2(1h)-pyridone | ||
|---|---|---|---|---|
| CAS Number | 22123-19-9 | Molecular Weight | 177.12400 | |
| Density | 1.315 g/cm3 | Boiling Point | 231.3ºC at 760 mmHg | |
| Molecular Formula | C7H6F3NO | Melting Point | 124-128 °C(lit.) | |
| MSDS | N/A | Flash Point | 93.7ºC | |
Use of 6-methyl-4-(trifluoromethyl)-2(1h)-pyridone |
| Name | 6-methyl-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315 g/cm3 |
|---|---|
| Boiling Point | 231.3ºC at 760 mmHg |
| Melting Point | 124-128 °C(lit.) |
| Molecular Formula | C7H6F3NO |
| Molecular Weight | 177.12400 |
| Flash Point | 93.7ºC |
| Exact Mass | 177.04000 |
| PSA | 32.86000 |
| LogP | 1.70210 |
| Vapour Pressure | 0.0629mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | CDRMKCNOGIBXOG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(F)(F)F)cc(=O)[nH]1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Methyl-4-(trifluoromethyl)pyridin-2(1H)-one |
| 6-methyl-4-trifluoromethyl-2-pyridone |
| 4-Trifluormethyl-6-methyl-pyridin-2-on |
| MFCD00042479 |
| 6-methyl-4-trifluoromethyl-1H-pyridin-2-one |
| 6-Methyl-4-trifluoromethyl-2(1H)-pyridone |