1 4-BIS(1 4 7 10-TETRAOXAUNDECYL)BENZEN& structure
|
Common Name | 1 4-BIS(1 4 7 10-TETRAOXAUNDECYL)BENZEN& | ||
|---|---|---|---|---|
| CAS Number | 221243-98-7 | Molecular Weight | 402.47900 | |
| Density | 1.1082 g/mL at 25ºC(lit.) | Boiling Point | 480ºC at 760 mmHg | |
| Molecular Formula | C20H34O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,4-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1082 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 480ºC at 760 mmHg |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.47900 |
| Flash Point | >230 °F |
| Exact Mass | 402.22500 |
| PSA | 73.84000 |
| LogP | 1.80340 |
| Vapour Pressure | 6.57E-09mmHg at 25°C |
| Index of Refraction | n20/D 1.4940(lit.) |
| InChIKey | GLFDQJMQVPBQCE-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOc1ccc(OCCOCCOCCOC)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| MFCD06411341 |
| 1,4-bis(triethoxymethoxy)benzene |
| 1,4-Bis(1,4,7,10-tetraoxaundecyl)benzene |
| 1,4-Bis(2-(2-(2-methoxyethoxy)ethoxy)ethoxy)benzene |