7,4'-Di-O-methylapigenin 5-O-xylosylglucoside structure
|
Common Name | 7,4'-Di-O-methylapigenin 5-O-xylosylglucoside | ||
|---|---|---|---|---|
| CAS Number | 221257-06-3 | Molecular Weight | 592.55 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 878.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C28H32O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.1±27.8 °C | |
Use of 7,4'-Di-O-methylapigenin 5-O-xylosylglucosideAgalloside is a neural stem cell differentiation activator that can be found in Aquilaria agallocha[1]. |
| Name | 7,4'-Di-O-methylapigenin 5-O-xylosylglucoside |
|---|---|
| Synonym | More Synonyms |
| Description | Agalloside is a neural stem cell differentiation activator that can be found in Aquilaria agallocha[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 878.9±65.0 °C at 760 mmHg |
| Molecular Formula | C28H32O14 |
| Molecular Weight | 592.55 |
| Flash Point | 290.1±27.8 °C |
| Exact Mass | 592.179199 |
| PSA | 206.97000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | ZTYIRUZJISZADH-AQLOEVPPSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC4OC(COC5OCC(O)C(O)C5O)C(O)C(O)C4O)cc(OC)cc3o2)cc1 |
| Hazard Codes | Xi |
|---|
| 4H-1-Benzopyran-4-one, 7-methoxy-2-(4-methoxyphenyl)-5-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]- |
| 7-Methoxy-2-(4-methoxyphenyl)-4-oxo-4H-chromen-5-yl 6-O-β-D-xylopyranosyl-β-D-glucopyranoside |