CD73-IN-4 structure
|
Common Name | CD73-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 2216764-29-1 | Molecular Weight | 463.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23ClN5O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CD73-IN-4CD73-IN-4 is a potent and selective methylenephosphonic acid CD73 inhibitor, with an IC50 of 2.6 nM for human CD73. CD73-IN-4 is potential for the research of cancer immunology. |
| Name | CD73-IN-4 |
|---|
| Description | CD73-IN-4 is a potent and selective methylenephosphonic acid CD73 inhibitor, with an IC50 of 2.6 nM for human CD73. CD73-IN-4 is potential for the research of cancer immunology. |
|---|
| Molecular Formula | C16H23ClN5O7P |
|---|---|
| Molecular Weight | 463.81 |
| InChIKey | IVHVIBKVJIZKOC-RTWAVKEYSA-N |
| SMILES | O=P(O)(O)COCC1OC(n2ncc3c(NC4CCCC4)nc(Cl)nc32)C(O)C1O |