Urea,N-(3-chloro-4-methylphenyl)-N'-methyl- structure
|
Common Name | Urea,N-(3-chloro-4-methylphenyl)-N'-methyl- | ||
|---|---|---|---|---|
| CAS Number | 22175-22-0 | Molecular Weight | 198.64900 | |
| Density | 1.245g/cm3 | Boiling Point | 280.1ºC at 760 mmHg | |
| Molecular Formula | C9H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.2ºC | |
| Name | 1-(3-chloro-4-methylphenyl)-3-methylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 280.1ºC at 760 mmHg |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.64900 |
| Flash Point | 123.2ºC |
| Exact Mass | 198.05600 |
| PSA | 41.13000 |
| LogP | 2.86360 |
| Vapour Pressure | 0.00386mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | GUMFWXBSFOHZDC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)NC)Cl |
| HS Code | 2924299090 |
|---|
|
~%
Urea,N-(3-chlor... CAS#:22175-22-0
Detail
|
| Literature: Fonne-Pfister, Raymonde; Kreuz, Klaus Phytochemistry (Elsevier), 1990 , vol. 29, # 9 p. 2793 - 2796 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3-chloro-4-methylphenyl)-1-methylurea |
| N-methyl-N'-(3-chloro-4-methylphenyl)-urea |
| N-(3-Chlor-4-methyl-phenyl)-N'-methyl-harnstoff |
| N-(3-CHLORO-4-METHYLPHENYL)-N'-METHYLUREA |