4-(trifluoromethyl)benzamidoxime structure
|
Common Name | 4-(trifluoromethyl)benzamidoxime | ||
|---|---|---|---|---|
| CAS Number | 22179-86-8 | Molecular Weight | 204.14900 | |
| Density | 1.4g/cm3 | Boiling Point | 297.1ºC at 760mmHg | |
| Molecular Formula | C8H7F3N2O | Melting Point | 125-130 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 133.5ºC | |
Use of 4-(trifluoromethyl)benzamidoxime |
| Name | 4-(trifluoromethyl)benzamidoxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 297.1ºC at 760mmHg |
| Melting Point | 125-130 °C(lit.) |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.14900 |
| Flash Point | 133.5ºC |
| Exact Mass | 204.05100 |
| PSA | 58.61000 |
| LogP | 2.50020 |
| Vapour Pressure | 0.000619mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | QCVFLUSIBKAKPC-UHFFFAOYSA-N |
| SMILES | NC(=NO)c1ccc(C(F)(F)F)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
|
~90%
4-(trifluoromet... CAS#:22179-86-8 |
| Literature: Edlin, Christopher David; Redshaw, Sally; Smith, Ian Edward David; Walter, Daryl Simon Patent: US2003/69276 A1, 2003 ; |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Discovery and structure-activity relationship of 3-aryl-5-aryl-1,2,4-oxadiazoles as a new series of apoptosis inducers and potential anticancer agents.
.PubMed ID We have identified 5-(3-chlorothiophen-2-yl)-3-(4-trifluoromethylphenyl)-1,2,4-oxadiazole (1d) as a novel apoptosis inducer through our caspase- and cell-based high-throughput screening assay. Compoun... |
| 4-TRIFLUOROMETHYLBENZAMIDE OXIME |
| N'-Hydroxy-4-(trifluoromethyl)benzimidamide |
| MFCD00053042 |
| 4-Trifluoromethylphenyl-amidoxime |
| N-HYDROXY-4-TRIFLUOROMETHYLBENZAMIDINE |
| 4-trifluoromethylbenzamidoxime |
| 4-Trifluormethlbenzamidoxim |