2-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 22227-59-4 | Molecular Weight | 269.562 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 329.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H3ClF3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3±27.9 °C | |
| Name | 2-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.8±42.0 °C at 760 mmHg |
| Molecular Formula | C8H3ClF3NO4 |
| Molecular Weight | 269.562 |
| Flash Point | 153.3±27.9 °C |
| Exact Mass | 268.970276 |
| PSA | 83.12000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | PSRPKTROFCUEOD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 2-chloro-3-nitro-5-(trifluoromethyl)- |
| 2-Chloro-3-nitro-5-(trifluoromethyl)benzoic acid |
| 3-carboxy-4-chloro-5-nitrobenzotrifluoride |
| 2-chloro-3-nitro-5-trifluoromethylbenzoic acid |
| 4-chloro-3-nitro-5-carboxylbenzotrifluoride |