1,4-Naphthalenedione,2-chloro-3-(pentylamino)- structure
|
Common Name | 1,4-Naphthalenedione,2-chloro-3-(pentylamino)- | ||
|---|---|---|---|---|
| CAS Number | 22272-16-8 | Molecular Weight | 277.74600 | |
| Density | 1.23g/cm3 | Boiling Point | 379.3ºC at 760mmHg | |
| Molecular Formula | C15H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.2ºC | |
| Name | 2-chloro-3-(pentylamino)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 379.3ºC at 760mmHg |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.74600 |
| Flash Point | 183.2ºC |
| Exact Mass | 277.08700 |
| PSA | 46.17000 |
| LogP | 3.68670 |
| Vapour Pressure | 5.91E-06mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | PJZWAOXJZMWKQG-UHFFFAOYSA-N |
| SMILES | CCCCCNC1=C(Cl)C(=O)c2ccccc2C1=O |
|
~93%
1,4-Naphthalene... CAS#:22272-16-8 |
| Literature: Lien, Jin-Cherng; Huang, Li-Jiau; Wang, Jih-Pyang; Teng, Che-Ming; Lee, Kuo-Hsiung; Kou, Sheng-Chu Bioorganic and Medicinal Chemistry, 1997 , vol. 5, # 12 p. 2111 - 2120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-chloro-3-pentylamino-1,4-naphthoquinone |
| 3-Pentylamino-2-chlor-1,4-naphthochinon |