2-Bromo-5-nitro-6-picoline structure
|
Common Name | 2-Bromo-5-nitro-6-picoline | ||
|---|---|---|---|---|
| CAS Number | 22282-96-8 | Molecular Weight | 217.020 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 274.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O2 | Melting Point | 69-70ºC | |
| MSDS | Chinese USA | Flash Point | 119.5±25.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-Bromo-6-methyl-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 274.0±35.0 °C at 760 mmHg |
| Melting Point | 69-70ºC |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.020 |
| Flash Point | 119.5±25.9 °C |
| Exact Mass | 215.953430 |
| PSA | 58.71000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | PCNVKBBKROTUNS-UHFFFAOYSA-N |
| SMILES | Cc1nc(Br)ccc1[N+](=O)[O-] |
| Storage condition | Refrigerator |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | T: Toxic;Xi: Irritant; |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~%
2-Bromo-5-nitro... CAS#:22282-96-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 5 p. 795 - 798 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Bromo-3-nitropicoline |
| MFCD03095219 |
| 6-Bromo-2-methyl-3-nitropyridine |
| 2-Bromo-5-nitro-6-picoline |
| Pyridine, 6-bromo-2-methyl-3-nitro- |