{1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine
Modify Date: 2026-07-16 19:10:50
![{1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine Structure](https://www.chemsrc.com/extcaspic/322/2228997-31-5.png)
{1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine structure
|
Common Name | {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine | ||
|---|---|---|---|---|
| CAS Number | 2228997-31-5 | Molecular Weight | 269.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H25F2N |
|---|---|
| Molecular Weight | 269.37 |
| InChIKey | XRWSVCLSKPZHFA-UHFFFAOYSA-N |
| SMILES | NCC1(CC23CC4CC(CC(C4)C2)C3)CC(F)(F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine? |
| A: CAS number of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine is 2228997-31-5. |
| Q: What is the molecular formula of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine? |
| A: Molecular formula of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine is C16H25F2N. |
| Q: What is the InChIKey of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine? |
| A: InChIKey of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine is XRWSVCLSKPZHFA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2228997-31-5? |
| A: Chinese name of 2228997-31-5 is 2228997-31-5. |
| Q: What is the molecular weight of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine? |
| A: Molecular weight of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine is 269.37. |
| Q: What is the English name of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine? |
| A: The English name of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine is {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine. |
| Q: What is the SMILES notation of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine? |
| A: SMILES notation of {1-[(Adamantan-1-yl)methyl]-3,3-difluorocyclobutyl}methanamine is NCC1(CC23CC4CC(CC(C4)C2)C3)CC(F)(F)C1. |