2-fluoro-6,11-dihydrothiochromeno[4,3-b]indole structure
|
Common Name | 2-fluoro-6,11-dihydrothiochromeno[4,3-b]indole | ||
|---|---|---|---|---|
| CAS Number | 22298-04-0 | Molecular Weight | 255.31000 | |
| Density | 1.401g/cm3 | Boiling Point | 486.4ºC at 760 mmHg | |
| Molecular Formula | C15H10FNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.9ºC | |
| Name | 2-fluoro-6,11-dihydrothiochromeno[4,3-b]indole |
|---|
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 486.4ºC at 760 mmHg |
| Molecular Formula | C15H10FNS |
| Molecular Weight | 255.31000 |
| Flash Point | 247.9ºC |
| Exact Mass | 255.05200 |
| PSA | 41.09000 |
| LogP | 4.57970 |
| Vapour Pressure | 3.86E-09mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | UKPBXHZXYAOIIE-UHFFFAOYSA-N |
| SMILES | Fc1ccc2c(c1)-c1[nH]c3ccccc3c1CS2 |
|
~%
2-fluoro-6,11-d... CAS#:22298-04-0 |
| Literature: Croisy,A. et al. Journal of Heterocyclic Chemistry, 1974 , vol. 11, p. 113 - 118 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |