ethyl 3-(N-(5-chloro-2-nitrophenyl)anilino)-3-oxopropanoate structure
|
Common Name | ethyl 3-(N-(5-chloro-2-nitrophenyl)anilino)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 22316-45-6 | Molecular Weight | 362.76400 | |
| Density | 1.371g/cm3 | Boiling Point | 581.9ºC at 760mmHg | |
| Molecular Formula | C17H15ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.7ºC | |
| Name | ethyl 3-(N-(5-chloro-2-nitrophenyl)anilino)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 581.9ºC at 760mmHg |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.76400 |
| Flash Point | 305.7ºC |
| Exact Mass | 362.06700 |
| PSA | 92.43000 |
| LogP | 4.38930 |
| Vapour Pressure | 1.56E-13mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | ZRYOWWCGEBQSKY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)N(c1ccccc1)c1cc(Cl)ccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
ethyl 3-(N-(5-c... CAS#:22316-45-6 |
| Literature: Roussel-UCLAF Patent: US3984398 A1, 1976 ; |
|
~%
ethyl 3-(N-(5-c... CAS#:22316-45-6 |
| Literature: Poupaert, Jacques H.; Guiot, Pierre; Jacqmin, Philippe; Dumont, Pierre European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 417 - 420 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Carbaethoxyacetyl-2-nitro-5-chlor-diphenylamin |
| N-carbethoxy acetyl 2-nitro 5-chloro diphenylamine |
| EINECS 244-907-1 |