5-Chloro-2-nitro-N-phenylaniline structure
|
Common Name | 5-Chloro-2-nitro-N-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 25781-92-4 | Molecular Weight | 248.665 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 370.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C12H9ClN2O2 | Melting Point | 110-114ºC | |
| MSDS | N/A | Flash Point | 177.8±25.1 °C | |
| Name | 5-chloro-2-nitro-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.4±32.0 °C at 760 mmHg |
| Melting Point | 110-114ºC |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.665 |
| Flash Point | 177.8±25.1 °C |
| Exact Mass | 248.035248 |
| PSA | 57.85000 |
| LogP | 4.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | FPKHZBVGKMTUHB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1Nc1ccccc1 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-chloro-3-phenylamino-4-nitrobenzene |
| Benzenamine, 5-chloro-2-nitro-N-phenyl- |
| EINECS 247-261-9 |
| 5-Chloro-2-nitrodiphenylamine |
| Benzenamine,5-chloro-2-nitro-N-phenyl |
| 5-chloro-2-nitro-N-phenyl-benzenamine |
| MFCD00007287 |
| 5-Chloro-2-nitro-N-phenylaniline |
| N-Phenyl-5-chlor-2-nitro-anilin |
| 5-Chlor-2-nitro-diphenylamin |