BMP-NTf2 structure
|
Common Name | BMP-NTf2 | ||
|---|---|---|---|---|
| CAS Number | 223437-11-4 | Molecular Weight | 422.40 | |
| Density | 1.40 | Boiling Point | 190.5ºC at 760mmHg | |
| Molecular Formula | C11H20F6N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 69ºC | |
Use of BMP-NTf2PYR14-TFSI is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | bis(trifluoromethylsulfonyl)azanide,1-butyl-1-methylpyrrolidin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Description | PYR14-TFSI is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.40 |
|---|---|
| Boiling Point | 190.5ºC at 760mmHg |
| Molecular Formula | C11H20F6N2O4S2 |
| Molecular Weight | 422.40 |
| Flash Point | 69ºC |
| Exact Mass | 422.076874 |
| PSA | 85.04000 |
| LogP | 5.20660 |
| Vapour Pressure | 0.54mmHg at 25°C |
| Index of Refraction | 1.4216 |
| InChIKey | HSLXOARVFIWOQF-UHFFFAOYSA-N |
| SMILES | CCCC[N+]1(C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| Storage condition | Store below +30°C. |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| WGK Germany | 3 |
|
~92%
BMP-NTf2 CAS#:223437-11-4 |
| Literature: Organic and Biomolecular Chemistry, , vol. 11, # 15 p. 2534 - 2542 |
|
~86%
BMP-NTf2 CAS#:223437-11-4 |
| Literature: Journal of Physical Chemistry B, , vol. 103, # 20 p. 4164 - 4170 |
|
~%
BMP-NTf2 CAS#:223437-11-4 |
| Literature: Journal of Chemical Physics, , vol. 122, # 18 art. no. 184512 |
|
~%
BMP-NTf2 CAS#:223437-11-4 |
| Literature: Journal of Molecular Liquids, , vol. 157, # 1 p. 43 - 50 |
|
~%
BMP-NTf2 CAS#:223437-11-4 |
| Literature: Electrochimica Acta, , vol. 55, # 28 p. 9019 - 9023 |
| 1-Butyl-1-methylpyrrolidinium bis[(trifluoromethyl)sulfonyl]azanide |
| [C(4)mpyr][NTf2] |
| 1-butyl-1-methylpyrrolidinium bis(trifluoromethylsulfonyl)amide |
| 1-butyl-1-methylpyrrolidinium bis(trifluoromethyl-sulfonyl)amide |
| 1-Butyl-1-methylpyrrolidinium bistriflimide |
| [C4C1Pyrr][NTf2] |
| N-butyl-N-methylpyrrolidinium-TFSI |
| [BMP][NTf2] |
| N-Butyl (methylpyrrolidinium bis(trifluoromethylsulfonyl)imide |
| 1-n-Butyl-1-Methylpyrrolidinium Bis(Trifluoromethylsulfonyl)Imide |
| MFCD07784447 |
| 1-butyl-1-methylpyrrolidinium bis(trifluoromethyl sulfonyl) amide |
| 1-methyl-1-butyl-pyrrolidinium bis(trifluoromethylsulfonyl)amide |
| 1-butyl-1-methylpyrrolidinium bis(trifluoromethylsulfonyl) amide |
| ([BMPyrr][NTf2]) |
| BMP-NTf2 |
| (BMPL) bis(trifluoromethylsulfonyl)imide |
| 1-butyl-1-methyl-pyrrolidinium bis(trifluoromethylsulfonyl)amide |
| 1-Butyl-1-methylpyrrolidinium Bis(trifluoromethanesulfonyl)imide |
| [pyrr14](1+)[NTf2](1-) |