2,3-Dichloro-5-nitropyridine structure
|
Common Name | 2,3-Dichloro-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 22353-40-8 | Molecular Weight | 192.988 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 267.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Cl2N2O2 | Melting Point | 51-56℃ | |
| MSDS | USA | Flash Point | 115.8±25.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2,3-Dichloro-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 267.9±35.0 °C at 760 mmHg |
| Melting Point | 51-56℃ |
| Molecular Formula | C5H2Cl2N2O2 |
| Molecular Weight | 192.988 |
| Flash Point | 115.8±25.9 °C |
| Exact Mass | 191.949326 |
| PSA | 58.71000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | XLPDVAVQKGDHNO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Cl)c(Cl)c1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933399090 |
|
~96%
2,3-Dichloro-5-... CAS#:22353-40-8 |
| Literature: Koch; Schnatterer Synthesis, 1990 , # 6 p. 499 - 501 |
|
~88%
2,3-Dichloro-5-... CAS#:22353-40-8 |
| Literature: Abbott Laboratories Patent: US6133253 A1, 2000 ; |
|
~%
2,3-Dichloro-5-... CAS#:22353-40-8 |
| Literature: Synthesis, , # 6 p. 499 - 501 |
|
~%
2,3-Dichloro-5-... CAS#:22353-40-8 |
| Literature: US6432880 B1, ; |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-Dichloro-5-nitropyridine |
| 2.3-Dichlor-5-nitro-pyridin |
| 2,3-dichloro-5-nitro pyridine |
| MFCD03840432 |
| T6NJ BG CG ENW |
| 2,3,5-TRIFLUOROPHENYLACETIC ACID |