2-(4-Nitrophenyl)-2-propanol
2-(4-Nitrophenyl)-2-propanol structure
|
Common Name | 2-(4-Nitrophenyl)-2-propanol | ||
|---|---|---|---|---|
| CAS Number | 22357-57-9 | Molecular Weight | 181.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11NO3 |
|---|---|
| Molecular Weight | 181.18900 |
| Exact Mass | 181.07400 |
| PSA | 66.05000 |
| LogP | 2.34540 |
| InChIKey | BCERWYLBCDENFU-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1ccc([N+](=O)[O-])cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:14500-58-4
CAS#:147-82-0
CAS#:67-64-1
CAS#:1830-68-8
CAS#:90862-12-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-nitro-phenyl)-propan-2-ol |
| 2-(4-nitrophenyl)propan-2-ol |
| 2-(4-nitrophenyl)-propan-2-ol |
| 4-nitrocumyl alcohol |
| 2-(4-Nitrophenyl)-2-propanol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: SMILES notation of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is CC(C)(O)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the polar surface area (PSA) of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: Polar surface area (PSA) of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is 66.05000. |
| Q: What English synonyms does 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine have? |
| A: English synonyms of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine: 2-(4-nitro-phenyl)-propan-2-ol, 2-(4-nitrophenyl)propan-2-ol, 2-(4-nitrophenyl)-propan-2-ol, 4-nitrocumyl alcohol, 2-(4-Nitrophenyl)-2-propanol. |
| Q: What is the molecular weight of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: Molecular weight of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is 181.18900. |
| Q: What are the downstream products of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: Related downstream products(CAS) of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine: 14500-58-4;147-82-0;67-64-1;1830-68-8;90862-12-7. |
| Q: What is the molecular formula of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: Molecular formula of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is C9H11NO3. |
| Q: What is the LogP of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: LogP of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is 2.34540. |
| Q: What is the English name of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: The English name of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine. |
| Q: What is the InChIKey of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: InChIKey of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is BCERWYLBCDENFU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine? |
| A: CAS number of 6-((3-((dimethylamino)methyl)benzyl)oxy)-9H-purin-2-amine is 22357-57-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |