2-(4-nitrophenyl)propan-2-yl N-phenylcarbamate structure
|
Common Name | 2-(4-nitrophenyl)propan-2-yl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 90862-12-7 | Molecular Weight | 300.30900 | |
| Density | 1.276g/cm3 | Boiling Point | 417.6ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.3ºC | |
| Name | 2-(4-nitrophenyl)propan-2-yl N-phenylcarbamate |
|---|
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 417.6ºC at 760 mmHg |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.30900 |
| Flash Point | 206.3ºC |
| Exact Mass | 300.11100 |
| PSA | 84.15000 |
| LogP | 4.67480 |
| Index of Refraction | 1.615 |
| InChIKey | FKKYGLHSPWOEAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)Nc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
2-(4-nitropheny... CAS#:90862-12-7 |
| Literature: Jordan, Elizabeth A.; Thorne, Melanie P. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 4 p. 647 - 654 |
|
~%
2-(4-nitropheny... CAS#:90862-12-7 |
| Literature: Jordan, Elizabeth A.; Thorne, Melanie P. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 4 p. 647 - 654 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |