tiadinil structure
|
Common Name | tiadinil | ||
|---|---|---|---|---|
| CAS Number | 223580-51-6 | Molecular Weight | 267.735 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3OS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of tiadinilTiadinil is a plant activator of systemic acquired resistance, boosts the production of herbivore-induced plant volatiles; insecticide agent. |
| Name | tiadinil |
|---|---|
| Synonym | More Synonyms |
| Description | Tiadinil is a plant activator of systemic acquired resistance, boosts the production of herbivore-induced plant volatiles; insecticide agent. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.735 |
| Exact Mass | 267.023315 |
| PSA | 83.12000 |
| LogP | 3.25 |
| Index of Refraction | 1.663 |
| InChIKey | VJQYLJSMBWXGDV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2snnc2C)cc1Cl |
| Storage condition | 2-8℃ |
| 3’-chloro-4,4’-dimethyl-1,2,3-thiadiazole-5-carboxanilide |
| r-4601 |
| 3'-chloro-4,4'-dimethyl-1,2,3-thiadiazole-5-carboxanilide |
| NNF 9850 |
| 3'-chloro-4,4'-dimethyl-1,2,3-thiadazole-5-carboxanilide |
| 1,2,3-Thiadiazole-5-carboxamide, N-(3-chloro-4-methylphenyl)-4-methyl- |
| N-(3-Chloro-4-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamide |
| TIADINIL STANDARD |
| tradinil |
| N5-(3-chloro-4-methylphenyl)-4-methyl-1,2,3-thiadiazole-5-carboxamide |
| tiadinil |