Integracin B structure
|
Common Name | Integracin B | ||
|---|---|---|---|---|
| CAS Number | 224186-05-4 | Molecular Weight | 586.79900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H54O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Integracin BIntegracin B is a potent dimeric alkyl aromatic inhibitor of HIV-1 integrase discovered from the screening of fungal extracts using an in vitro assay. Integracin B inhibits both coupled and strand transfer activity of HIV-1 integrase[1]. |
| Name | integracins B |
|---|---|
| Synonym | More Synonyms |
| Description | Integracin B is a potent dimeric alkyl aromatic inhibitor of HIV-1 integrase discovered from the screening of fungal extracts using an in vitro assay. Integracin B inhibits both coupled and strand transfer activity of HIV-1 integrase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C35H54O7 |
|---|---|
| Molecular Weight | 586.79900 |
| Exact Mass | 586.38700 |
| PSA | 127.45000 |
| LogP | 8.46190 |
| InChIKey | IKNYNBVDLOWJFN-AKGWNBJDSA-N |
| SMILES | CCCC(O)CCCCCCCc1cc(O)cc(O)c1C(=O)OC(CCC)CCCCCCCc1cc(O)cc(O)c1 |
|
~%
Integracin B CAS#:224186-05-4 |
| Literature: Liu, Hai-Li; Huang, Xiao-Yin; Li, Jia; Xin, Guo-Rong; Guo, Yue-Wei Chirality, 2012 , vol. 24, # 6 p. 459 - 462 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| integracin b |