Benzimidazole,5,6-dimethyl-2-morpholino-1-b-D-ribofuranosyl- (8CI) structure
|
Common Name | Benzimidazole,5,6-dimethyl-2-morpholino-1-b-D-ribofuranosyl- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 22423-21-8 | Molecular Weight | 363.40800 | |
| Density | 1.52g/cm3 | Boiling Point | 654.9ºC at 760 mmHg | |
| Molecular Formula | C18H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.9ºC | |
| Name | 2-(5,6-dimethyl-2-morpholin-4-ylbenzimidazol-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 654.9ºC at 760 mmHg |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.40800 |
| Flash Point | 349.9ºC |
| Exact Mass | 363.17900 |
| PSA | 100.21000 |
| LogP | 0.16620 |
| Vapour Pressure | 4.83E-18mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | XXWBSWGLONZBPI-UHFFFAOYSA-N |
| SMILES | Cc1cc2nc(N3CCOCC3)n(C3OC(CO)C(O)C3O)c2cc1C |
|
~%
Benzimidazole,5... CAS#:22423-21-8 |
| Literature: Revankar,G.R.; Townsend,L.B. Journal of Heterocyclic Chemistry, 1968 , vol. 5, p. 615 - 620 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,6-dimethyl-2-(morpholin-4-yl)-1-pentofuranosyl-1h-benzimidazole |