(2-Nitrophenyl)(phenyl)methanone
Modify Date: 2025-09-16 10:59:23
(2-Nitrophenyl)(phenyl)methanone structure
|
Common Name | (2-Nitrophenyl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 2243-79-0 | Molecular Weight | 227.21500 | |
| Density | 1.266 g/cm3 | Boiling Point | 407.6ºC at 760 mmHg | |
| Molecular Formula | C13H9NO3 | Melting Point | 105 °C | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | (2-Nitrophenyl)(phenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266 g/cm3 |
|---|---|
| Boiling Point | 407.6ºC at 760 mmHg |
| Melting Point | 105 °C |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.21500 |
| Flash Point | 202.4ºC |
| Exact Mass | 227.05800 |
| PSA | 62.89000 |
| LogP | 3.34900 |
| Vapour Pressure | 7.48E-07mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | UJHSIDUUJPTLDY-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-Benzoyl-2-nitrobenzol |
| 1-Benzoyl-2-methyl-3-carbamoylmethyl-5-methoxyindol |
| o-nitrobenzophenone |
| 1H-Indole-3-acetamide,1-benzoyl-5-methoxy-2-methyl |
| 2-nitrobenzophenone |
| o-nitrobenzophenones |
| 2-Nitrobenzophenon |