Butanoic acid,4-[(4-nitrobenzoyl)amino]- structure
|
Common Name | Butanoic acid,4-[(4-nitrobenzoyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 22433-20-1 | Molecular Weight | 252.22300 | |
| Density | 1.357g/cm3 | Boiling Point | 546.3ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.2ºC | |
| Name | 4-[(4-nitrobenzoyl)amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 546.3ºC at 760 mmHg |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.22300 |
| Flash Point | 284.2ºC |
| Exact Mass | 252.07500 |
| PSA | 112.22000 |
| LogP | 2.10350 |
| Vapour Pressure | 9.06E-13mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | MTLNHDZIBNYGRT-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
Butanoic acid,4... CAS#:22433-20-1 |
| Literature: Anandan, Sampath-Kumar; Gless, Richard D. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 9 p. 2740 - 2744 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-{[(4-nitrophenyl)carbonyl]amino}butanoic acid |
| 4-(p-Nitrobenzamido)-buttersaeure |