3-phenyl-4H-benzo[f]quinazolin-1-one structure
|
Common Name | 3-phenyl-4H-benzo[f]quinazolin-1-one | ||
|---|---|---|---|---|
| CAS Number | 22440-22-8 | Molecular Weight | 272.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenyl-4H-benzo[f]quinazolin-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H12N2O |
|---|---|
| Molecular Weight | 272.30100 |
| Exact Mass | 272.09500 |
| PSA | 46.01000 |
| LogP | 4.15560 |
| InChIKey | GYWSDXGYOGWZEI-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2ccc3ccccc3c12 |
|
~%
3-phenyl-4H-ben... CAS#:22440-22-8 |
| Literature: Mehta; Patel Indian Journal of Chemistry, 1968 , vol. 6, p. 294,296 |
|
~%
3-phenyl-4H-ben... CAS#:22440-22-8 |
| Literature: Mehta; Patel Indian Journal of Chemistry, 1968 , vol. 6, p. 294,296 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Phenyl-1-oxo-1.2-dihydro-benzo<f>chinazolin |