Py-MAA-Val-Cit-PAB-MMAE
Modify Date: 2025-09-24 14:27:00
Py-MAA-Val-Cit-PAB-MMAE structure
|
Common Name | Py-MAA-Val-Cit-PAB-MMAE | ||
|---|---|---|---|---|
| CAS Number | 2247398-68-9 | Molecular Weight | 1446.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C72H111N13O16S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Py-MAA-Val-Cit-PAB-MMAEPy-MAA-Val-Cit-PAB-MMAE (AAJ8D6-PY-Val-Cit-MMAE) is an ADC Linker of Zapadcine-3a. Zapadcine-3a is an anti-TRAILR2 ADC with broad spectrum, and antineoplastic effect. Zapadcine-3a can be swallowed up into lysosome of tumor cells by binding to TRAILR2. Then Zapadcine-3a releases small molecular compound to specifically kill various TRAILR2-pos. Zapadcine-3a potently eradicates tumor cells and cures tumor[1]. |
| Name | Py-MAA-Val-Cit-PAB-MMAE |
|---|
| Description | Py-MAA-Val-Cit-PAB-MMAE (AAJ8D6-PY-Val-Cit-MMAE) is an ADC Linker of Zapadcine-3a. Zapadcine-3a is an anti-TRAILR2 ADC with broad spectrum, and antineoplastic effect. Zapadcine-3a can be swallowed up into lysosome of tumor cells by binding to TRAILR2. Then Zapadcine-3a releases small molecular compound to specifically kill various TRAILR2-pos. Zapadcine-3a potently eradicates tumor cells and cures tumor[1]. |
|---|---|
| Related Catalog | |
| Target |
CD262 |
| References |
| Molecular Formula | C72H111N13O16S |
|---|---|
| Molecular Weight | 1446.79 |
| InChIKey | ASDXMJBJAKMFHO-NGASZDMPSA-N |
| SMILES | C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)CCSCC(=O)NC(C(=O)NC(CCCNC(N)=O)C(=O)Nc2ccc(COC(=O)N(C)C(C(=O)NC(C(=O)N(C)C(C(C)CC)C(CC(=O)N3CCCC3C(OC)C(C)C(=O)NC(C)C(O)c3ccccc3)OC)C(C)C)C(C)C)cc2)C(C)C)C1 |