benzoin isobutyl ether structure
|
Common Name | benzoin isobutyl ether | ||
|---|---|---|---|---|
| CAS Number | 22499-12-3 | Molecular Weight | 268.35000 | |
| Density | 0.985 g/mL at 25 °C(lit.) | Boiling Point | 133 °C0.5 mm Hg(lit.) | |
| Molecular Formula | C18H20O2 | Melting Point | 23 °C | |
| MSDS | N/A | Flash Point | 185 °F | |
| Name | benzoin isobutyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 0.985 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 133 °C0.5 mm Hg(lit.) |
| Melting Point | 23 °C |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35000 |
| Flash Point | 185 °F |
| Exact Mass | 268.14600 |
| PSA | 26.30000 |
| LogP | 4.28320 |
| Vapour Pressure | 6.44E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.5485(lit.) |
| InChIKey | JMVZGKVGQDHWOI-UHFFFAOYSA-N |
| SMILES | CC(C)COC(C(=O)c1ccccc1)c1ccccc1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| RTECS | KM5782265 |
| HS Code | 2914509090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| O-isobutylbenzoin |
| MFCD00008933 |
| EINECS 245-039-6 |
| Triganol |
| Vicure 10 |
| Isobutyl benzoin ether |
| BNZOIN ISOBUTYL ETHER |
| benzoin isobutylether |
| 2-Isobutoxy-2-phenylacetophenone |