1-(5-Fluoro-2-nitrophenyl)ethanone structure
|
Common Name | 1-(5-Fluoro-2-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 2250-48-8 | Molecular Weight | 183.137 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 296.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C8H6FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.2±21.8 °C | |
| Name | 1-(5-Fluoro-2-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.6±20.0 °C at 760 mmHg |
| Molecular Formula | C8H6FNO3 |
| Molecular Weight | 183.137 |
| Flash Point | 133.2±21.8 °C |
| Exact Mass | 183.033173 |
| PSA | 62.89000 |
| LogP | 1.18 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | VPAGKEZJDCSVOW-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(F)ccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
|
~%
1-(5-Fluoro-2-n... CAS#:2250-48-8 |
| Literature: Imperial Chemical Industries PLC Patent: US5176737 A1, 1993 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5-Fluor-2-nitro-acetophenon |
| 1-(5-fluoro-2-nitro-phenyl)-ethanone |
| 1-(5-Fluoro-2-nitrophenyl)ethanone |
| 2'-nitro-5'-fluoroacetophenone |
| 5'-Fluoro-2'-nitroacetophenone |
| 2'-Nitro-5'-fluor-acetophenon |
| Ethanone, 1-(5-fluoro-2-nitrophenyl)- |