2H-Tetrazole,5-[4-(trifluoromethyl)phenyl] structure
|
Common Name | 2H-Tetrazole,5-[4-(trifluoromethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 2251-79-8 | Molecular Weight | 214.14700 | |
| Density | 1.464g/cm3 | Boiling Point | 315.2ºC at 760mmHg | |
| Molecular Formula | C8H5F3N4 | Melting Point | 226°C | |
| MSDS | N/A | Flash Point | 144.4ºC | |
| Name | 5-[4-(trifluoromethyl)phenyl]-2H-tetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 315.2ºC at 760mmHg |
| Melting Point | 226°C |
| Molecular Formula | C8H5F3N4 |
| Molecular Weight | 214.14700 |
| Flash Point | 144.4ºC |
| Exact Mass | 214.04700 |
| PSA | 54.46000 |
| LogP | 1.88550 |
| InChIKey | CCVCHQBLMDMSNN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(-c2nn[nH]n2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933990090 |
|
~98%
2H-Tetrazole,5-... CAS#:2251-79-8 |
| Literature: Sharghi, Hashem; Ebrahimpourmoghaddam, Sakineh; Doroodmand, Mohammad Mahdi Journal of Organometallic Chemistry, 2013 , vol. 738, p. 41 - 48 |
|
~60%
2H-Tetrazole,5-... CAS#:2251-79-8 |
| Literature: Sridhar, Madabhushi; Mallu, Kishore Kumar Reddy; Jillella, Raveendra; Godala, Kondalreddy; Beeram, Chinaramanaiah; Chinthala, Narsaiah Synthesis (Germany), 2013 , vol. 45, # 4 art. no. SS-2012-Z0887-OP, p. 507 - 510 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 5-[4-(Trifluoromethyl)Phenyl]-2H-1,2,3,4-Tetrazole |
| 5-(4'-(trifluoromethyl)phenyl)tetrazole |
| 5-[4-(Trifluoromethyl)phenyl]-1H-tetrazole |
| MFCD00052525 |
| 5-(4-trifluoromethylphenyl)-1H-tetrazol |