Benzene,1,2-dichloro-4-(2,4-dinitrophenoxy)- structure
|
Common Name | Benzene,1,2-dichloro-4-(2,4-dinitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 22532-87-2 | Molecular Weight | 329.09200 | |
| Density | 1.585g/cm3 | Boiling Point | 418ºC at 760mmHg | |
| Molecular Formula | C12H6Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
| Name | 1-(3,4-dichlorophenoxy)-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 418ºC at 760mmHg |
| Molecular Formula | C12H6Cl2N2O5 |
| Molecular Weight | 329.09200 |
| Flash Point | 206.6ºC |
| Exact Mass | 327.96500 |
| PSA | 100.87000 |
| LogP | 5.64850 |
| Vapour Pressure | 8.24E-07mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | MWWQAKDVCAXEIB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4-dichlorophenyl 2,4-dinitrophenyl ether |