Galactose 1-phosphate structure
|
Common Name | Galactose 1-phosphate | ||
|---|---|---|---|---|
| CAS Number | 2255-14-3 | Molecular Weight | 260.13600 | |
| Density | 1.9g/cm3 | Boiling Point | 603ºC at 760mmHg | |
| Molecular Formula | C6H13O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.5ºC | |
Use of Galactose 1-phosphateGalactose 1-phosphate is an intermediate in the galactose metabolism and nucleotide sugars. |
| Name | D-galactopyranose 1-phosphate |
|---|---|
| Synonym | More Synonyms |
| Description | Galactose 1-phosphate is an intermediate in the galactose metabolism and nucleotide sugars. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.9g/cm3 |
|---|---|
| Boiling Point | 603ºC at 760mmHg |
| Molecular Formula | C6H13O9P |
| Molecular Weight | 260.13600 |
| Flash Point | 318.5ºC |
| Exact Mass | 260.03000 |
| PSA | 166.72000 |
| Vapour Pressure | 4.68E-17mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | HXXFSFRBOHSIMQ-FPRJBGLDSA-N |
| SMILES | O=P(O)(O)OC1OC(CO)C(O)C(O)C1O |
| Storage condition | 2-8℃ |
| D-Galactose 1-phosphate |
| [(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| galactose-1-phosphate |
| Glukose-1-phosphat |
| glucosyl phosphate |
| glucose-1-phosphate |