Thiophene,2-[(2,4-dinitrophenyl)thio]
Modify Date: 2025-10-02 13:50:26
![Thiophene,2-[(2,4-dinitrophenyl)thio] Structure](https://image.chemsrc.com/caspic/466/22552-36-9.png)
Thiophene,2-[(2,4-dinitrophenyl)thio] structure
|
Common Name | Thiophene,2-[(2,4-dinitrophenyl)thio] | ||
|---|---|---|---|---|
| CAS Number | 22552-36-9 | Molecular Weight | 282.29600 | |
| Density | 1.58g/cm3 | Boiling Point | 430.5ºC at 760mmHg | |
| Molecular Formula | C10H6N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | 2-(2,4-dinitrophenyl)sulfanylthiophene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760mmHg |
| Molecular Formula | C10H6N2O4S2 |
| Molecular Weight | 282.29600 |
| Flash Point | 214.1ºC |
| Exact Mass | 281.97700 |
| PSA | 145.18000 |
| LogP | 4.76210 |
| Vapour Pressure | 3.25E-07mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | OIJMOPQXAVRIII-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Sc2cccs2)c([N+](=O)[O-])c1 |
|
~88%
Thiophene,2-[(2... CAS#:22552-36-9 |
| Literature: GUILFORD PHARMACEUTICALS INC. Patent: WO2005/53609 A2, 2005 ; Location in patent: Page/Page column 22 ; WO 2005/053609 A2 |
|
~%
Thiophene,2-[(2... CAS#:22552-36-9 |
| Literature: Buess; Kharasch Journal of the American Chemical Society, 1959 , vol. 72, p. 3529,3530, 3531 |
CAS#:55564-37-9|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 2, Current Page 1 of 1
1
| 2-Thienyl-(2',4'-dinitrophenyl)-sulfid |
| Thienyl-(2)-<2,4-dinitro-phenyl>-sulfid |
| 2-(2,4-dinitrophenylthio)thiophene |
| 2-[(2,4-dinitrophenyl)sulfanyl]thiophene |
| 2-(2,4-Dinitrophenylmercapto)-thiophen |
| (2,4-Dinitro-phenyl)-(thienyl-(2)>-sulfid |